5fibonacci sayisi.fw min

Python Hazır Kodlar 05 | Fibonacci Sayısı

Fibonacci sayısını hesaplayan bir program yazalım.

Yöntem 1: Özyineleme:
def Fibonacci(n): 
    if n<0: 
        print("Yanlış Sayı Girdiniz") 
    # Birinci Fibonacci sayısı return 0
    elif n==1: 
        return 0
    # İkinci Fibonacci sayısı return 1
    elif n==2: 
        return 1
    else: 
        return Fibonacci(n-1)+Fibonacci(n-2) 
  

# Programı Çalıştıralım
print(Fibonacci(9)) 
Yöntem 2: Dinamik Programlama:
# İlk iki fibonacci sayısını 0 ve 1 olarak alalım
  
FibArray = [0,1] 
  
def fibonacci(n): 
    if n<0: 
        print("Yanlış Sayı Girdiniz") 
    elif n<=len(FibArray): 
        return FibArray[n-1] 
    else: 
        temp_fib = fibonacci(n-1)+fibonacci(n-2) 
        FibArray.append(temp_fib) 
        return temp_fib 
  
# Programı Çalıştıralım
print(fibonacci(9)) 
Yöntem 3: Bir sayının Fibonacci sayısı olup olmadığını kontrol etme:
# math kütüphanesini import ediyoruz
import math 
  
def isPerfectSquare(x): 
    s = int(math.sqrt(x)) 
    return s*s == x 
  
# N bir fibonacci sayısı ise true değilse false döndür
def isFibonacci(n): 
  
    return isPerfectSquare(5*n*n + 4) or isPerfectSquare(5*n*n - 4) 
     
# 1 ile 11 arasında ki sayıları test edelim 
for i in range(1,11): 
     if (isFibonacci(i) == True): 
         print (i,"sayısı Fibonacci Sayısıdır")
     else: 
         print (i,"sayısı Fibonacci Sayısı Değildir")

Python dersleri için buraya gidebilirsiniz..

İletişim: admin@herseymi.com
Yazı oluşturuldu 96

Bir Yorum Yazın

Benzer yazılar

Aramak istediğinizi üstte yazmaya başlayın ve aramak için enter tuşuna basın. İptal için ESC tuşuna basın.

Üste dön